C38H22N4SSe — CID 168740232
8-(4-dibenzothiophen-4-yl-6-phenyl-1,3,5-triazin-2-yl)-2-phenylbenzo[g][1,3]benzoselenazole (PubChem CID 168740232) has the molecular formula C38H22N4SSe and a molecular weight of 645.65 g/mol. Its IUPAC name is 8-(4-dibenzothiophen-4-yl-6-phenyl-1,3,5-triazin-2-yl)-2-phenylbenzo[g][1,3]benzoselenazole.
| Compound Name | 8-(4-dibenzothiophen-4-yl-6-phenyl-1,3,5-triazin-2-yl)-2-phenylbenzo[g][1,3]benzoselenazole |
|---|---|
| PubChem CID | 168740232 |
| Molecular Formula | C38H22N4SSe |
| Molecular Weight | 645.65 g/mol |
| Exact Mass | 646.07 |
| IUPAC Name | 8-(4-dibenzothiophen-4-yl-6-phenyl-1,3,5-triazin-2-yl)-2-phenylbenzo[g][1,3]benzoselenazole |
| SMILES | c1ccc(-c2nc(-c3ccc4ccc5nc(-c6ccccc6)[se]c5c4c3)nc(-c3cccc4c3sc3ccccc34)n2)cc1 |
| InChI | InChI=1S/C38H22N4SSe/c1-3-10-24(11-4-1)35-40-36(42-37(41-35)29-16-9-15-28-27-14-7-8-17-32(27)43-33(28)29)26-19-18-23-20-21-31-34(30(23)22-26)44-38(39-31)25-12-5-2-6-13-25/h1-22H |
| InChIKey | GKUPGRVXMQIKJY-UHFFFAOYSA-N |
| XLogP | 9.67 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.65 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|