C26H25N3O3S3 — CID 16874500
N-[3-(1,3-benzothiazol-2-yl)-4,5-dimethylthiophen-2-yl]-4-[bis(prop-2-enyl)sulfamoyl]benzamide (PubChem CID 16874500) has the molecular formula C26H25N3O3S3 and a molecular weight of 523.71 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)-4,5-dimethylthiophen-2-yl]-4-[bis(prop-2-enyl)sulfamoyl]benzamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)-4,5-dimethylthiophen-2-yl]-4-[bis(prop-2-enyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 16874500 |
| Molecular Formula | C26H25N3O3S3 |
| Molecular Weight | 523.71 g/mol |
| Exact Mass | 523.11 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)-4,5-dimethylthiophen-2-yl]-4-[bis(prop-2-enyl)sulfamoyl]benzamide |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1ccc(C(=O)Nc2sc(C)c(C)c2-c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C26H25N3O3S3/c1-5-15-29(16-6-2)35(31,32)20-13-11-19(12-14-20)24(30)28-26-23(17(3)18(4)33-26)25-27-21-9-7-8-10-22(21)34-25/h5-14H,1-2,15-16H2,3-4H3,(H,28,30) |
| InChIKey | XYFKFHSCFUXWJE-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.71 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|