C12H22N2O3 — CID 168749459
N-[(2S)-1-acetamido-4-methyl-3-oxopentan-2-yl]-2-methylpropanamide (PubChem CID 168749459) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is N-[(2S)-1-acetamido-4-methyl-3-oxopentan-2-yl]-2-methylpropanamide.
| Compound Name | N-[(2S)-1-acetamido-4-methyl-3-oxopentan-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 168749459 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | N-[(2S)-1-acetamido-4-methyl-3-oxopentan-2-yl]-2-methylpropanamide |
| SMILES | CC(=O)NC[C@H](NC(=O)C(C)C)C(=O)C(C)C |
| InChI | InChI=1S/C12H22N2O3/c1-7(2)11(16)10(6-13-9(5)15)14-12(17)8(3)4/h7-8,10H,6H2,1-5H3,(H,13,15)(H,14,17)/t10-/m0/s1 |
| InChIKey | SVDGKPNEABTBHV-JTQLQIEISA-N |
| XLogP | 0.49 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |