C14H25NO3 — CID 159866906
N-[(2S,5R)-5,7-dimethyl-3,6-dioxooctan-2-yl]-2-methylpropanamide (PubChem CID 159866906) has the molecular formula C14H25NO3 and a molecular weight of 255.36 g/mol. Its IUPAC name is N-[(2S,5R)-5,7-dimethyl-3,6-dioxooctan-2-yl]-2-methylpropanamide.
| Compound Name | N-[(2S,5R)-5,7-dimethyl-3,6-dioxooctan-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 159866906 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | N-[(2S,5R)-5,7-dimethyl-3,6-dioxooctan-2-yl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)N[C@@H](C)C(=O)C[C@@H](C)C(=O)C(C)C |
| InChI | InChI=1S/C14H25NO3/c1-8(2)13(17)10(5)7-12(16)11(6)15-14(18)9(3)4/h8-11H,7H2,1-6H3,(H,15,18)/t10-,11+/m1/s1 |
| InChIKey | ITVQOPHCRAPTLM-MNOVXSKESA-N |
| XLogP | 1.97 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |