C16H28N2O4 — CID 158753511
2-methyl-4-oxo-5-(5-oxohexanoylamino)-N-propan-2-ylhexanamide (PubChem CID 158753511) has the molecular formula C16H28N2O4 and a molecular weight of 312.41 g/mol. Its IUPAC name is 2-methyl-4-oxo-5-(5-oxohexanoylamino)-N-propan-2-ylhexanamide.
| Compound Name | 2-methyl-4-oxo-5-(5-oxohexanoylamino)-N-propan-2-ylhexanamide |
|---|---|
| PubChem CID | 158753511 |
| Molecular Formula | C16H28N2O4 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 2-methyl-4-oxo-5-(5-oxohexanoylamino)-N-propan-2-ylhexanamide |
| SMILES | CC(=O)CCCC(=O)NC(C)C(=O)CC(C)C(=O)NC(C)C |
| InChI | InChI=1S/C16H28N2O4/c1-10(2)17-16(22)11(3)9-14(20)13(5)18-15(21)8-6-7-12(4)19/h10-11,13H,6-9H2,1-5H3,(H,17,22)(H,18,21) |
| InChIKey | FXLYXKCSDOGAQA-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |