C30H46N4O9S — CID 160786863
5-[4-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]butanoylamino]-2-methyl-4-oxo-N-[3-oxo-5-(4-oxopentylsulfanyl)pentan-2-yl]hexanamide (PubChem CID 160786863) has the molecular formula C30H46N4O9S and a molecular weight of 638.78 g/mol. Its IUPAC name is 5-[4-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]butanoylamino]-2-methyl-4-oxo-N-[3-oxo-5-(4-oxopentylsulfanyl)pentan-2-yl]hexanamide.
| Compound Name | 5-[4-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]butanoylamino]-2-methyl-4-oxo-N-[3-oxo-5-(4-oxopentylsulfanyl)pentan-2-yl]hexanamide |
|---|---|
| PubChem CID | 160786863 |
| Molecular Formula | C30H46N4O9S |
| Molecular Weight | 638.78 g/mol |
| Exact Mass | 638.30 |
| IUPAC Name | 5-[4-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]butanoylamino]-2-methyl-4-oxo-N-[3-oxo-5-(4-oxopentylsulfanyl)pentan-2-yl]hexanamide |
| SMILES | CC(=O)CCCSCCC(=O)C(C)NC(=O)C(C)CC(=O)C(C)NC(=O)CCCOCCNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C30H46N4O9S/c1-20(30(42)33-22(3)24(36)12-18-44-17-6-7-21(2)35)19-25(37)23(4)32-27(39)8-5-15-43-16-13-31-26(38)11-14-34-28(40)9-10-29(34)41/h9-10,20,22-23H,5-8,11-19H2,1-4H3,(H,31,38)(H,32,39)(H,33,42) |
| InChIKey | JPPHTJYKUNLTMM-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 185.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.78 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|