C29H45N3O7S — CID 158044260
9-(2,5-dioxopyrrol-1-yl)-2-methyl-N-[5-methyl-3,6-dioxo-6-(6-oxoheptylsulfanylmethylamino)hexan-2-yl]-4-oxononanamide (PubChem CID 158044260) has the molecular formula C29H45N3O7S and a molecular weight of 579.76 g/mol. Its IUPAC name is 9-(2,5-dioxopyrrol-1-yl)-2-methyl-N-[5-methyl-3,6-dioxo-6-(6-oxoheptylsulfanylmethylamino)hexan-2-yl]-4-oxononanamide.
| Compound Name | 9-(2,5-dioxopyrrol-1-yl)-2-methyl-N-[5-methyl-3,6-dioxo-6-(6-oxoheptylsulfanylmethylamino)hexan-2-yl]-4-oxononanamide |
|---|---|
| PubChem CID | 158044260 |
| Molecular Formula | C29H45N3O7S |
| Molecular Weight | 579.76 g/mol |
| Exact Mass | 579.30 |
| IUPAC Name | 9-(2,5-dioxopyrrol-1-yl)-2-methyl-N-[5-methyl-3,6-dioxo-6-(6-oxoheptylsulfanylmethylamino)hexan-2-yl]-4-oxononanamide |
| SMILES | CC(=O)CCCCCSCNC(=O)C(C)CC(=O)C(C)NC(=O)C(C)CC(=O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C29H45N3O7S/c1-20(17-24(34)12-8-5-9-15-32-26(36)13-14-27(32)37)29(39)31-23(4)25(35)18-21(2)28(38)30-19-40-16-10-6-7-11-22(3)33/h13-14,20-21,23H,5-12,15-19H2,1-4H3,(H,30,38)(H,31,39) |
| InChIKey | XXSHANVWSVZYQE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 146.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.76 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|