About 2-chlorododecane
2-chlorododecane (PubChem CID 16875) has the molecular formula C12H25Cl
and a molecular weight of 204.78 g/mol. Its IUPAC name is 2-chlorododecane.
Molecular Properties
| Compound Name | 2-chlorododecane |
| PubChem CID | 16875 |
| Molecular Formula | C12H25Cl |
| Molecular Weight | 204.78 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 2-chlorododecane |
| SMILES | CCCCCCCCCCC(C)Cl |
| InChI | InChI=1S/C12H25Cl/c1-3-4-5-6-7-8-9-10-11-12(2)13/h12H,3-11H2,1-2H3 |
| InChIKey | IRQJPTVOWBXCHM-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 204.78 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chlorododecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chlorododecane?
The IUPAC name of 2-chlorododecane (CID 16875) is 2-chlorododecane.
What is the SMILES notation for 2-chlorododecane?
The canonical SMILES for 2-chlorododecane is CCCCCCCCCCC(C)Cl.
What is the InChIKey of 2-chlorododecane?
The InChIKey is IRQJPTVOWBXCHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25Cl/c1-3-4-5-6-7-8-9-10-11-12(2)13/h12H,3-11H2,1-2H3.
What are the key properties of 2-chlorododecane?
2-chlorododecane has a molecular weight of 204.78 g/mol, XLogP of 5.14, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chlorododecane is sourced from PubChem (CID 16875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).