C15H14N4O — CID 168750262
N-[(5-isocyano-2-pyridinyl)methyl]-3,4-dihydro-2H-pyrano[3,2-b]pyridin-4-amine (PubChem CID 168750262) has the molecular formula C15H14N4O and a molecular weight of 266.30 g/mol. Its IUPAC name is N-[(5-isocyano-2-pyridinyl)methyl]-3,4-dihydro-2H-pyrano[3,2-b]pyridin-4-amine.
| Compound Name | N-[(5-isocyano-2-pyridinyl)methyl]-3,4-dihydro-2H-pyrano[3,2-b]pyridin-4-amine |
|---|---|
| PubChem CID | 168750262 |
| Molecular Formula | C15H14N4O |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | N-[(5-isocyano-2-pyridinyl)methyl]-3,4-dihydro-2H-pyrano[3,2-b]pyridin-4-amine |
| SMILES | [C-]#[N+]c1ccc(CNC2CCOc3cccnc32)nc1 |
| InChI | InChI=1S/C15H14N4O/c1-16-11-4-5-12(18-9-11)10-19-13-6-8-20-14-3-2-7-17-15(13)14/h2-5,7,9,13,19H,6,8,10H2 |
| InChIKey | YUBYEFYBUBBFKZ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 51.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|