C13H19N3O3 — CID 154115939
4-(3,4-dihydro-2H-pyrano[3,2-b]pyridin-4-ylamino)butylcarbamic acid (PubChem CID 154115939) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-pyrano[3,2-b]pyridin-4-ylamino)butylcarbamic acid.
| Compound Name | 4-(3,4-dihydro-2H-pyrano[3,2-b]pyridin-4-ylamino)butylcarbamic acid |
|---|---|
| PubChem CID | 154115939 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 4-(3,4-dihydro-2H-pyrano[3,2-b]pyridin-4-ylamino)butylcarbamic acid |
| SMILES | O=C(O)NCCCCNC1CCOc2cccnc21 |
| InChI | InChI=1S/C13H19N3O3/c17-13(18)16-7-2-1-6-14-10-5-9-19-11-4-3-8-15-12(10)11/h3-4,8,10,14,16H,1-2,5-7,9H2,(H,17,18) |
| InChIKey | SJXCTARUTHWAKM-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|