C25H24ClF3N2O5 — CID 168751601
(2S)-2-[[3-chloro-5-[[4-(trifluoromethoxy)phenyl]methoxy]isoquinoline-6-carbonyl]amino]-3,3-dimethylpentanoic acid (PubChem CID 168751601) has the molecular formula C25H24ClF3N2O5 and a molecular weight of 524.92 g/mol. Its IUPAC name is (2S)-2-[[3-chloro-5-[[4-(trifluoromethoxy)phenyl]methoxy]isoquinoline-6-carbonyl]amino]-3,3-dimethylpentanoic acid.
| Compound Name | (2S)-2-[[3-chloro-5-[[4-(trifluoromethoxy)phenyl]methoxy]isoquinoline-6-carbonyl]amino]-3,3-dimethylpentanoic acid |
|---|---|
| PubChem CID | 168751601 |
| Molecular Formula | C25H24ClF3N2O5 |
| Molecular Weight | 524.92 g/mol |
| Exact Mass | 524.13 |
| IUPAC Name | (2S)-2-[[3-chloro-5-[[4-(trifluoromethoxy)phenyl]methoxy]isoquinoline-6-carbonyl]amino]-3,3-dimethylpentanoic acid |
| SMILES | CCC(C)(C)[C@H](NC(=O)c1ccc2cnc(Cl)cc2c1OCc1ccc(OC(F)(F)F)cc1)C(=O)O |
| InChI | InChI=1S/C25H24ClF3N2O5/c1-4-24(2,3)21(23(33)34)31-22(32)17-10-7-15-12-30-19(26)11-18(15)20(17)35-13-14-5-8-16(9-6-14)36-25(27,28)29/h5-12,21H,4,13H2,1-3H3,(H,31,32)(H,33,34)/t21-/m1/s1 |
| InChIKey | WNCZZDRFGRMIKL-OAQYLSRUSA-N |
| XLogP | 5.99 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.92 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|