C26H23F3N2O5 — CID 168751623
(2S)-2-[[7-isocyano-1-[[4-(trifluoromethoxy)phenyl]methoxy]naphthalene-2-carbonyl]amino]-3,3-dimethylbutanoic acid (PubChem CID 168751623) has the molecular formula C26H23F3N2O5 and a molecular weight of 500.47 g/mol. Its IUPAC name is (2S)-2-[[7-isocyano-1-[[4-(trifluoromethoxy)phenyl]methoxy]naphthalene-2-carbonyl]amino]-3,3-dimethylbutanoic acid.
| Compound Name | (2S)-2-[[7-isocyano-1-[[4-(trifluoromethoxy)phenyl]methoxy]naphthalene-2-carbonyl]amino]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 168751623 |
| Molecular Formula | C26H23F3N2O5 |
| Molecular Weight | 500.47 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | (2S)-2-[[7-isocyano-1-[[4-(trifluoromethoxy)phenyl]methoxy]naphthalene-2-carbonyl]amino]-3,3-dimethylbutanoic acid |
| SMILES | [C-]#[N+]c1ccc2ccc(C(=O)N[C@H](C(=O)O)C(C)(C)C)c(OCc3ccc(OC(F)(F)F)cc3)c2c1 |
| InChI | InChI=1S/C26H23F3N2O5/c1-25(2,3)22(24(33)34)31-23(32)19-12-8-16-7-9-17(30-4)13-20(16)21(19)35-14-15-5-10-18(11-6-15)36-26(27,28)29/h5-13,22H,14H2,1-3H3,(H,31,32)(H,33,34)/t22-/m1/s1 |
| InChIKey | LPQPPSRJLMUCPM-JOCHJYFZSA-N |
| XLogP | 6.10 |
| TPSA | 89.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.47 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|