C25H35N5O3 — CID 168752869
N-hydroxy-N-[[4-[4-(2-methylmorpholin-4-yl)anilino]phenyl]methyl]-2-(4-methylpiperazin-1-yl)acetamide (PubChem CID 168752869) has the molecular formula C25H35N5O3 and a molecular weight of 453.59 g/mol. Its IUPAC name is N-hydroxy-N-[[4-[4-(2-methylmorpholin-4-yl)anilino]phenyl]methyl]-2-(4-methylpiperazin-1-yl)acetamide.
| Compound Name | N-hydroxy-N-[[4-[4-(2-methylmorpholin-4-yl)anilino]phenyl]methyl]-2-(4-methylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 168752869 |
| Molecular Formula | C25H35N5O3 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | N-hydroxy-N-[[4-[4-(2-methylmorpholin-4-yl)anilino]phenyl]methyl]-2-(4-methylpiperazin-1-yl)acetamide |
| SMILES | CC1CN(c2ccc(Nc3ccc(CN(O)C(=O)CN4CCN(C)CC4)cc3)cc2)CCO1 |
| InChI | InChI=1S/C25H35N5O3/c1-20-17-29(15-16-33-20)24-9-7-23(8-10-24)26-22-5-3-21(4-6-22)18-30(32)25(31)19-28-13-11-27(2)12-14-28/h3-10,20,26,32H,11-19H2,1-2H3 |
| InChIKey | UJEGMOGBLRVPIO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 71.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|