C61H49N3 — CID 168756347
2,4-bis(4-tert-butylphenyl)-6-[3-[1-(4-fluoranthen-3-ylphenyl)naphthalen-2-yl]phenyl]-1,3,5-triazine (PubChem CID 168756347) has the molecular formula C61H49N3 and a molecular weight of 824.08 g/mol. Its IUPAC name is 2,4-bis(4-tert-butylphenyl)-6-[3-[1-(4-fluoranthen-3-ylphenyl)naphthalen-2-yl]phenyl]-1,3,5-triazine.
| Compound Name | 2,4-bis(4-tert-butylphenyl)-6-[3-[1-(4-fluoranthen-3-ylphenyl)naphthalen-2-yl]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 168756347 |
| Molecular Formula | C61H49N3 |
| Molecular Weight | 824.08 g/mol |
| Exact Mass | 823.39 |
| IUPAC Name | 2,4-bis(4-tert-butylphenyl)-6-[3-[1-(4-fluoranthen-3-ylphenyl)naphthalen-2-yl]phenyl]-1,3,5-triazine |
| SMILES | CC(C)(C)c1ccc(-c2nc(-c3ccc(C(C)(C)C)cc3)nc(-c3cccc(-c4ccc5ccccc5c4-c4ccc(-c5ccc6c7c(cccc57)-c5ccccc5-6)cc4)c3)n2)cc1 |
| InChI | InChI=1S/C61H49N3/c1-60(2,3)45-30-25-41(26-31-45)57-62-58(42-27-32-46(33-28-42)61(4,5)6)64-59(63-57)44-15-11-14-43(37-44)49-34-29-38-13-7-8-16-48(38)55(49)40-23-21-39(22-24-40)47-35-36-54-51-18-10-9-17-50(51)53-20-12-19-52(47)56(53)54/h7-37H,1-6H3 |
| InChIKey | PUKNJSRTFDIBOQ-UHFFFAOYSA-N |
| XLogP | 16.42 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.08 |
| LogP ≤ 5 | 16.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |