C53H33N3 — CID 168756531
2-[4-[2-(3-fluoranthen-8-ylphenyl)naphthalen-1-yl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 168756531) has the molecular formula C53H33N3 and a molecular weight of 711.87 g/mol. Its IUPAC name is 2-[4-[2-(3-fluoranthen-8-ylphenyl)naphthalen-1-yl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[4-[2-(3-fluoranthen-8-ylphenyl)naphthalen-1-yl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 168756531 |
| Molecular Formula | C53H33N3 |
| Molecular Weight | 711.87 g/mol |
| Exact Mass | 711.27 |
| IUPAC Name | 2-[4-[2-(3-fluoranthen-8-ylphenyl)naphthalen-1-yl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-c4c(-c5cccc(-c6ccc7c(c6)-c6cccc8cccc-7c68)c5)ccc5ccccc45)cc3)n2)cc1 |
| InChI | InChI=1S/C53H33N3/c1-3-13-37(14-4-1)51-54-52(38-15-5-2-6-16-38)56-53(55-51)39-26-24-36(25-27-39)49-43-21-8-7-12-34(43)28-30-44(49)42-20-9-19-40(32-42)41-29-31-45-46-22-10-17-35-18-11-23-47(50(35)46)48(45)33-41/h1-33H |
| InChIKey | VCNQYINIJAODFZ-UHFFFAOYSA-N |
| XLogP | 13.83 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.87 |
| LogP ≤ 5 | 13.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |