C15H20ClN5O2S — CID 168756705
1-chloro-4-[4-[2-[(hydroxysulfonimidoyl)amino]ethyl]piperidin-1-yl]phthalazine (PubChem CID 168756705) has the molecular formula C15H20ClN5O2S and a molecular weight of 369.88 g/mol. Its IUPAC name is 1-chloro-4-[4-[2-[(hydroxysulfonimidoyl)amino]ethyl]piperidin-1-yl]phthalazine.
| Compound Name | 1-chloro-4-[4-[2-[(hydroxysulfonimidoyl)amino]ethyl]piperidin-1-yl]phthalazine |
|---|---|
| PubChem CID | 168756705 |
| Molecular Formula | C15H20ClN5O2S |
| Molecular Weight | 369.88 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 1-chloro-4-[4-[2-[(hydroxysulfonimidoyl)amino]ethyl]piperidin-1-yl]phthalazine |
| SMILES | [H]N=S(=O)(O)NCCC1CCN(c2nnc(Cl)c3ccccc23)CC1 |
| InChI | InChI=1S/C15H20ClN5O2S/c16-14-12-3-1-2-4-13(12)15(20-19-14)21-9-6-11(7-10-21)5-8-18-24(17,22)23/h1-4,11H,5-10H2,(H3,17,18,22,23) |
| InChIKey | JRAASAPCQJIDRT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.88 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |