C16H20ClN5O2 — CID 87371385
2-[1-(4-chlorophthalazin-1-yl)-3-(dimethylamino)azetidin-3-yl]ethylcarbamic acid (PubChem CID 87371385) has the molecular formula C16H20ClN5O2 and a molecular weight of 349.82 g/mol. Its IUPAC name is 2-[1-(4-chlorophthalazin-1-yl)-3-(dimethylamino)azetidin-3-yl]ethylcarbamic acid.
| Compound Name | 2-[1-(4-chlorophthalazin-1-yl)-3-(dimethylamino)azetidin-3-yl]ethylcarbamic acid |
|---|---|
| PubChem CID | 87371385 |
| Molecular Formula | C16H20ClN5O2 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 2-[1-(4-chlorophthalazin-1-yl)-3-(dimethylamino)azetidin-3-yl]ethylcarbamic acid |
| SMILES | CN(C)C1(CCNC(=O)O)CN(c2nnc(Cl)c3ccccc23)C1 |
| InChI | InChI=1S/C16H20ClN5O2/c1-21(2)16(7-8-18-15(23)24)9-22(10-16)14-12-6-4-3-5-11(12)13(17)19-20-14/h3-6,18H,7-10H2,1-2H3,(H,23,24) |
| InChIKey | HVDWIORCIGXDKH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |