About 2-morpholin-4-ium-4-ylethyl 3-sulfanylpropanoate
2-morpholin-4-ium-4-ylethyl 3-sulfanylpropanoate (PubChem CID 168757856) has the molecular formula C9H18NO3S+
and a molecular weight of 220.31 g/mol. Its IUPAC name is 2-morpholin-4-ium-4-ylethyl 3-sulfanylpropanoate.
Molecular Properties
| Compound Name | 2-morpholin-4-ium-4-ylethyl 3-sulfanylpropanoate |
| PubChem CID | 168757856 |
| Molecular Formula | C9H18NO3S+ |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 2-morpholin-4-ium-4-ylethyl 3-sulfanylpropanoate |
| SMILES | O=C(CCS)OCC[NH+]1CCOCC1 |
| InChI | InChI=1S/C9H17NO3S/c11-9(1-8-14)13-7-4-10-2-5-12-6-3-10/h14H,1-8H2/p+1 |
| InChIKey | VZKSRDIVQSHOEH-UHFFFAOYSA-O |
| XLogP | -1.24 |
| TPSA | 39.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-morpholin-4-ium-4-ylethyl 3-sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-ium-4-ylethyl 3-sulfanylpropanoate?
The IUPAC name of 2-morpholin-4-ium-4-ylethyl 3-sulfanylpropanoate (CID 168757856) is 2-morpholin-4-ium-4-ylethyl 3-sulfanylpropanoate.
What is the SMILES notation for 2-morpholin-4-ium-4-ylethyl 3-sulfanylpropanoate?
The canonical SMILES for 2-morpholin-4-ium-4-ylethyl 3-sulfanylpropanoate is O=C(CCS)OCC[NH+]1CCOCC1.
What is the InChIKey of 2-morpholin-4-ium-4-ylethyl 3-sulfanylpropanoate?
The InChIKey is VZKSRDIVQSHOEH-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H17NO3S/c11-9(1-8-14)13-7-4-10-2-5-12-6-3-10/h14H,1-8H2/p+1.
What are the key properties of 2-morpholin-4-ium-4-ylethyl 3-sulfanylpropanoate?
2-morpholin-4-ium-4-ylethyl 3-sulfanylpropanoate has a molecular weight of 220.31 g/mol, XLogP of -1.24, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-ium-4-ylethyl 3-sulfanylpropanoate is sourced from PubChem (CID 168757856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).