About [4-(4-chlorophenyl)piperidin-1-ium-4-yl] 2-sulfanylpropanoate
[4-(4-chlorophenyl)piperidin-1-ium-4-yl] 2-sulfanylpropanoate (PubChem CID 168757963) has the molecular formula C14H19ClNO2S+
and a molecular weight of 300.83 g/mol. Its IUPAC name is [4-(4-chlorophenyl)piperidin-1-ium-4-yl] 2-sulfanylpropanoate.
Molecular Properties
| Compound Name | [4-(4-chlorophenyl)piperidin-1-ium-4-yl] 2-sulfanylpropanoate |
| PubChem CID | 168757963 |
| Molecular Formula | C14H19ClNO2S+ |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | [4-(4-chlorophenyl)piperidin-1-ium-4-yl] 2-sulfanylpropanoate |
| SMILES | CC(S)C(=O)OC1(c2ccc(Cl)cc2)CC[NH2+]CC1 |
| InChI | InChI=1S/C14H18ClNO2S/c1-10(19)13(17)18-14(6-8-16-9-7-14)11-2-4-12(15)5-3-11/h2-5,10,16,19H,6-9H2,1H3/p+1 |
| InChIKey | PTHAKEPRYYBPLM-UHFFFAOYSA-O |
| XLogP | 1.75 |
| TPSA | 42.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [4-(4-chlorophenyl)piperidin-1-ium-4-yl] 2-sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-chlorophenyl)piperidin-1-ium-4-yl] 2-sulfanylpropanoate?
The IUPAC name of [4-(4-chlorophenyl)piperidin-1-ium-4-yl] 2-sulfanylpropanoate (CID 168757963) is [4-(4-chlorophenyl)piperidin-1-ium-4-yl] 2-sulfanylpropanoate.
What is the SMILES notation for [4-(4-chlorophenyl)piperidin-1-ium-4-yl] 2-sulfanylpropanoate?
The canonical SMILES for [4-(4-chlorophenyl)piperidin-1-ium-4-yl] 2-sulfanylpropanoate is CC(S)C(=O)OC1(c2ccc(Cl)cc2)CC[NH2+]CC1.
What is the InChIKey of [4-(4-chlorophenyl)piperidin-1-ium-4-yl] 2-sulfanylpropanoate?
The InChIKey is PTHAKEPRYYBPLM-UHFFFAOYSA-O. The full InChI is InChI=1S/C14H18ClNO2S/c1-10(19)13(17)18-14(6-8-16-9-7-14)11-2-4-12(15)5-3-11/h2-5,10,16,19H,6-9H2,1H3/p+1.
What are the key properties of [4-(4-chlorophenyl)piperidin-1-ium-4-yl] 2-sulfanylpropanoate?
[4-(4-chlorophenyl)piperidin-1-ium-4-yl] 2-sulfanylpropanoate has a molecular weight of 300.83 g/mol, XLogP of 1.75, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-chlorophenyl)piperidin-1-ium-4-yl] 2-sulfanylpropanoate is sourced from PubChem (CID 168757963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).