C15H20ClNO2 — CID 174662539
[3-(4-chlorophenyl)pyrrolidin-3-yl] 2,2-dimethylpropanoate (PubChem CID 174662539) has the molecular formula C15H20ClNO2 and a molecular weight of 281.78 g/mol. Its IUPAC name is [3-(4-chlorophenyl)pyrrolidin-3-yl] 2,2-dimethylpropanoate.
| Compound Name | [3-(4-chlorophenyl)pyrrolidin-3-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 174662539 |
| Molecular Formula | C15H20ClNO2 |
| Molecular Weight | 281.78 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | [3-(4-chlorophenyl)pyrrolidin-3-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC1(c2ccc(Cl)cc2)CCNC1 |
| InChI | InChI=1S/C15H20ClNO2/c1-14(2,3)13(18)19-15(8-9-17-10-15)11-4-6-12(16)7-5-11/h4-7,17H,8-10H2,1-3H3 |
| InChIKey | GYEUTWIWFCWDRM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.78 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |