C18H27NO3 — CID 174818718
[3-(4-methoxyphenyl)azepan-3-yl] 2,2-dimethylpropanoate (PubChem CID 174818718) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is [3-(4-methoxyphenyl)azepan-3-yl] 2,2-dimethylpropanoate.
| Compound Name | [3-(4-methoxyphenyl)azepan-3-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 174818718 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | [3-(4-methoxyphenyl)azepan-3-yl] 2,2-dimethylpropanoate |
| SMILES | COc1ccc(C2(OC(=O)C(C)(C)C)CCCCNC2)cc1 |
| InChI | InChI=1S/C18H27NO3/c1-17(2,3)16(20)22-18(11-5-6-12-19-13-18)14-7-9-15(21-4)10-8-14/h7-10,19H,5-6,11-13H2,1-4H3 |
| InChIKey | AKRCYBRTOWNPGY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |