About (3-phenylpiperidin-3-yl) 2-iodo-2-methylpropanoate
(3-phenylpiperidin-3-yl) 2-iodo-2-methylpropanoate (PubChem CID 162508404) has the molecular formula C15H20INO2
and a molecular weight of 373.23 g/mol. Its IUPAC name is (3-phenylpiperidin-3-yl) 2-iodo-2-methylpropanoate.
Molecular Properties
| Compound Name | (3-phenylpiperidin-3-yl) 2-iodo-2-methylpropanoate |
| PubChem CID | 162508404 |
| Molecular Formula | C15H20INO2 |
| Molecular Weight | 373.23 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | (3-phenylpiperidin-3-yl) 2-iodo-2-methylpropanoate |
| SMILES | CC(C)(I)C(=O)OC1(c2ccccc2)CCCNC1 |
| InChI | InChI=1S/C15H20INO2/c1-14(2,16)13(18)19-15(9-6-10-17-11-15)12-7-4-3-5-8-12/h3-5,7-8,17H,6,9-11H2,1-2H3 |
| InChIKey | XZBRPWXTJVNCEM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.23 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (3-phenylpiperidin-3-yl) 2-iodo-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-phenylpiperidin-3-yl) 2-iodo-2-methylpropanoate?
The IUPAC name of (3-phenylpiperidin-3-yl) 2-iodo-2-methylpropanoate (CID 162508404) is (3-phenylpiperidin-3-yl) 2-iodo-2-methylpropanoate.
What is the SMILES notation for (3-phenylpiperidin-3-yl) 2-iodo-2-methylpropanoate?
The canonical SMILES for (3-phenylpiperidin-3-yl) 2-iodo-2-methylpropanoate is CC(C)(I)C(=O)OC1(c2ccccc2)CCCNC1.
What is the InChIKey of (3-phenylpiperidin-3-yl) 2-iodo-2-methylpropanoate?
The InChIKey is XZBRPWXTJVNCEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20INO2/c1-14(2,16)13(18)19-15(9-6-10-17-11-15)12-7-4-3-5-8-12/h3-5,7-8,17H,6,9-11H2,1-2H3.
What are the key properties of (3-phenylpiperidin-3-yl) 2-iodo-2-methylpropanoate?
(3-phenylpiperidin-3-yl) 2-iodo-2-methylpropanoate has a molecular weight of 373.23 g/mol, XLogP of 3.02, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-phenylpiperidin-3-yl) 2-iodo-2-methylpropanoate is sourced from PubChem (CID 162508404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).