C12H16ClNO2 — CID 59444236
(3R,4S)-4-(4-chlorophenyl)-3-methylpiperidine-3,4-diol (PubChem CID 59444236) has the molecular formula C12H16ClNO2 and a molecular weight of 241.72 g/mol. Its IUPAC name is (3R,4S)-4-(4-chlorophenyl)-3-methylpiperidine-3,4-diol.
| Compound Name | (3R,4S)-4-(4-chlorophenyl)-3-methylpiperidine-3,4-diol |
|---|---|
| PubChem CID | 59444236 |
| Molecular Formula | C12H16ClNO2 |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | (3R,4S)-4-(4-chlorophenyl)-3-methylpiperidine-3,4-diol |
| SMILES | C[C@@]1(O)CNCC[C@]1(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H16ClNO2/c1-11(15)8-14-7-6-12(11,16)9-2-4-10(13)5-3-9/h2-5,14-16H,6-8H2,1H3/t11-,12+/m1/s1 |
| InChIKey | BPYFPHLACAAQBK-NEPJUHHUSA-N |
| XLogP | 1.27 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |