C49H57BN2 — CID 168759524
13-(2,4,5,7-tetratert-butyl-9,9-dimethylacridin-10-yl)-1-aza-13-borapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8,10,12(20),14,16,18-nonaene (PubChem CID 168759524) has the molecular formula C49H57BN2 and a molecular weight of 684.82 g/mol. Its IUPAC name is 13-(2,4,5,7-tetratert-butyl-9,9-dimethylacridin-10-yl)-1-aza-13-borapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8,10,12(20),14,16,18-nonaene.
| Compound Name | 13-(2,4,5,7-tetratert-butyl-9,9-dimethylacridin-10-yl)-1-aza-13-borapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8,10,12(20),14,16,18-nonaene |
|---|---|
| PubChem CID | 168759524 |
| Molecular Formula | C49H57BN2 |
| Molecular Weight | 684.82 g/mol |
| Exact Mass | 684.46 |
| IUPAC Name | 13-(2,4,5,7-tetratert-butyl-9,9-dimethylacridin-10-yl)-1-aza-13-borapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8,10,12(20),14,16,18-nonaene |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c2c(c1)C(C)(C)c1cc(C(C)(C)C)cc(C(C)(C)C)c1N2B1c2ccccc2-n2c3ccccc3c3cccc1c32 |
| InChI | InChI=1S/C49H57BN2/c1-45(2,3)30-26-34(47(7,8)9)43-36(28-30)49(13,14)37-29-31(46(4,5)6)27-35(48(10,11)12)44(37)52(43)50-38-22-16-18-25-41(38)51-40-24-17-15-20-32(40)33-21-19-23-39(50)42(33)51/h15-29H,1-14H3 |
| InChIKey | UPQZTWJRGHEMMB-UHFFFAOYSA-N |
| XLogP | 11.87 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.82 |
| LogP ≤ 5 | 11.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|