C35H14BN7 — CID 168759635
6-isocyano-9-(4-isocyano-1-aza-13-borapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8,10,12(20),14,16,18-nonaen-13-yl)carbazole-1,3,8-tricarbonitrile (PubChem CID 168759635) has the molecular formula C35H14BN7 and a molecular weight of 543.36 g/mol. Its IUPAC name is 6-isocyano-9-(4-isocyano-1-aza-13-borapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8,10,12(20),14,16,18-nonaen-13-yl)carbazole-1,3,8-tricarbonitrile.
| Compound Name | 6-isocyano-9-(4-isocyano-1-aza-13-borapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8,10,12(20),14,16,18-nonaen-13-yl)carbazole-1,3,8-tricarbonitrile |
|---|---|
| PubChem CID | 168759635 |
| Molecular Formula | C35H14BN7 |
| Molecular Weight | 543.36 g/mol |
| Exact Mass | 543.14 |
| IUPAC Name | 6-isocyano-9-(4-isocyano-1-aza-13-borapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8,10,12(20),14,16,18-nonaen-13-yl)carbazole-1,3,8-tricarbonitrile |
| SMILES | [C-]#[N+]c1cc(C#N)c2c(c1)c1cc(C#N)cc(C#N)c1n2B1c2ccccc2-n2c3cc([N+]#[C-])ccc3c3cccc1c32 |
| InChI | InChI=1S/C35H14BN7/c1-40-23-10-11-25-26-6-5-8-30-35(26)42(32(25)16-23)31-9-4-3-7-29(31)36(30)43-33-21(18-38)12-20(17-37)13-27(33)28-15-24(41-2)14-22(19-39)34(28)43/h3-16H |
| InChIKey | SHNYOWIPFUYRNO-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 89.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.36 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|