C38H17BN6 — CID 168759453
9-(1-aza-17-borahexacyclo[14.7.1.02,7.08,24.09,14.018,23]tetracosa-2,4,6,8(24),9,11,13,15,18,20,22-undecaen-17-yl)-6-isocyanocarbazole-1,3,8-tricarbonitrile (PubChem CID 168759453) has the molecular formula C38H17BN6 and a molecular weight of 568.41 g/mol. Its IUPAC name is 9-(1-aza-17-borahexacyclo[14.7.1.02,7.08,24.09,14.018,23]tetracosa-2,4,6,8(24),9,11,13,15,18,20,22-undecaen-17-yl)-6-isocyanocarbazole-1,3,8-tricarbonitrile.
| Compound Name | 9-(1-aza-17-borahexacyclo[14.7.1.02,7.08,24.09,14.018,23]tetracosa-2,4,6,8(24),9,11,13,15,18,20,22-undecaen-17-yl)-6-isocyanocarbazole-1,3,8-tricarbonitrile |
|---|---|
| PubChem CID | 168759453 |
| Molecular Formula | C38H17BN6 |
| Molecular Weight | 568.41 g/mol |
| Exact Mass | 568.16 |
| IUPAC Name | 9-(1-aza-17-borahexacyclo[14.7.1.02,7.08,24.09,14.018,23]tetracosa-2,4,6,8(24),9,11,13,15,18,20,22-undecaen-17-yl)-6-isocyanocarbazole-1,3,8-tricarbonitrile |
| SMILES | [C-]#[N+]c1cc(C#N)c2c(c1)c1cc(C#N)cc(C#N)c1n2B1c2ccccc2-n2c3ccccc3c3c4ccccc4cc1c32 |
| InChI | InChI=1S/C38H17BN6/c1-43-26-16-25(21-42)37-30(18-26)29-15-22(19-40)14-24(20-41)36(29)45(37)39-31-11-5-7-13-34(31)44-33-12-6-4-10-28(33)35-27-9-3-2-8-23(27)17-32(39)38(35)44/h2-18H |
| InChIKey | JRMHTTWCFIXGBE-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 85.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.41 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|