C34H32BNSi2 — CID 168759753
5-(5,5-dimethylbenzo[b][1,4]benzosilaborinin-10-yl)-10,10-dimethyl-4-phenylbenzo[b][1,4]benzazasiline (PubChem CID 168759753) has the molecular formula C34H32BNSi2 and a molecular weight of 521.62 g/mol. Its IUPAC name is 5-(5,5-dimethylbenzo[b][1,4]benzosilaborinin-10-yl)-10,10-dimethyl-4-phenylbenzo[b][1,4]benzazasiline.
| Compound Name | 5-(5,5-dimethylbenzo[b][1,4]benzosilaborinin-10-yl)-10,10-dimethyl-4-phenylbenzo[b][1,4]benzazasiline |
|---|---|
| PubChem CID | 168759753 |
| Molecular Formula | C34H32BNSi2 |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | 5-(5,5-dimethylbenzo[b][1,4]benzosilaborinin-10-yl)-10,10-dimethyl-4-phenylbenzo[b][1,4]benzazasiline |
| SMILES | C[Si]1(C)c2ccccc2B(N2c3ccccc3[Si](C)(C)c3cccc(-c4ccccc4)c32)c2ccccc21 |
| InChI | InChI=1S/C34H32BNSi2/c1-37(2)30-21-11-8-18-27(30)35(28-19-9-12-22-31(28)37)36-29-20-10-13-23-32(29)38(3,4)33-24-14-17-26(34(33)36)25-15-6-5-7-16-25/h5-24H,1-4H3 |
| InChIKey | AKYIHUABIDRBRO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|