C60H41NSSi — CID 168762689
[4-(3-dibenzothiophen-1-ylcarbazol-9-yl)-3,5-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]-triphenylsilane (PubChem CID 168762689) has the molecular formula C60H41NSSi and a molecular weight of 846.21 g/mol. Its IUPAC name is [4-(3-dibenzothiophen-1-ylcarbazol-9-yl)-3,5-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]-triphenylsilane.
| Compound Name | [4-(3-dibenzothiophen-1-ylcarbazol-9-yl)-3,5-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]-triphenylsilane |
|---|---|
| PubChem CID | 168762689 |
| Molecular Formula | C60H41NSSi |
| Molecular Weight | 846.21 g/mol |
| Exact Mass | 845.34 |
| IUPAC Name | [4-(3-dibenzothiophen-1-ylcarbazol-9-yl)-3,5-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]-triphenylsilane |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cc([Si](c3ccccc3)(c3ccccc3)c3ccccc3)cc(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])c2-n2c3ccccc3c3cc(-c4cccc5sc6ccccc6c45)ccc32)c([2H])c1[2H] |
| InChI | InChI=1S/C60H41NSSi/c1-6-21-42(22-7-1)52-40-48(63(45-25-10-3-11-26-45,46-27-12-4-13-28-46)47-29-14-5-15-30-47)41-53(43-23-8-2-9-24-43)60(52)61-55-34-18-16-31-50(55)54-39-44(37-38-56(54)61)49-33-20-36-58-59(49)51-32-17-19-35-57(51)62-58/h1-41H/i1D,2D,6D,7D,8D,9D,21D,22D,23D,24D |
| InChIKey | MEXBZPDBXWIOCO-KSRXAUCBSA-N |
| XLogP | 13.53 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.21 |
| LogP ≤ 5 | 13.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|