C60H36N2OS — CID 177077284
3-[9-(4-dibenzofuran-1-ylphenyl)carbazol-3-yl]-9-[9-(2,3,4,5,6-pentadeuteriophenyl)dibenzothiophen-3-yl]carbazole (PubChem CID 177077284) has the molecular formula C60H36N2OS and a molecular weight of 838.06 g/mol. Its IUPAC name is 3-[9-(4-dibenzofuran-1-ylphenyl)carbazol-3-yl]-9-[9-(2,3,4,5,6-pentadeuteriophenyl)dibenzothiophen-3-yl]carbazole.
| Compound Name | 3-[9-(4-dibenzofuran-1-ylphenyl)carbazol-3-yl]-9-[9-(2,3,4,5,6-pentadeuteriophenyl)dibenzothiophen-3-yl]carbazole |
|---|---|
| PubChem CID | 177077284 |
| Molecular Formula | C60H36N2OS |
| Molecular Weight | 838.06 g/mol |
| Exact Mass | 837.29 |
| IUPAC Name | 3-[9-(4-dibenzofuran-1-ylphenyl)carbazol-3-yl]-9-[9-(2,3,4,5,6-pentadeuteriophenyl)dibenzothiophen-3-yl]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc3sc4cc(-n5c6ccccc6c6cc(-c7ccc8c(c7)c7ccccc7n8-c7ccc(-c8cccc9oc%10ccccc%10c89)cc7)ccc65)ccc4c23)c([2H])c1[2H] |
| InChI | InChI=1S/C60H36N2OS/c1-2-12-37(13-3-1)44-18-11-23-57-60(44)48-31-30-42(36-58(48)64-57)62-52-20-8-5-15-46(52)50-35-40(27-33-54(50)62)39-26-32-53-49(34-39)45-14-4-7-19-51(45)61(53)41-28-24-38(25-29-41)43-17-10-22-56-59(43)47-16-6-9-21-55(47)63-56/h1-36H/i1D,2D,3D,12D,13D |
| InChIKey | UGWNPNNTPHYYNW-AYAICNHJSA-N |
| XLogP | 17.15 |
| TPSA | 23.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.06 |
| LogP ≤ 5 | 17.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |