C54H32N2O2 — CID 177077333
3-(9-dibenzofuran-4-ylcarbazol-3-yl)-9-[9-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-2-yl]carbazole (PubChem CID 177077333) has the molecular formula C54H32N2O2 and a molecular weight of 745.89 g/mol. Its IUPAC name is 3-(9-dibenzofuran-4-ylcarbazol-3-yl)-9-[9-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-2-yl]carbazole.
| Compound Name | 3-(9-dibenzofuran-4-ylcarbazol-3-yl)-9-[9-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-2-yl]carbazole |
|---|---|
| PubChem CID | 177077333 |
| Molecular Formula | C54H32N2O2 |
| Molecular Weight | 745.89 g/mol |
| Exact Mass | 745.28 |
| IUPAC Name | 3-(9-dibenzofuran-4-ylcarbazol-3-yl)-9-[9-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-2-yl]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc3oc4ccc(-n5c6ccccc6c6cc(-c7ccc8c(c7)c7ccccc7n8-c7cccc8c7oc7ccccc78)ccc65)cc4c23)c([2H])c1[2H] |
| InChI | InChI=1S/C54H32N2O2/c1-2-12-33(13-3-1)37-17-11-23-52-53(37)44-32-36(26-29-51(44)57-52)55-45-19-7-4-14-38(45)42-30-34(24-27-47(42)55)35-25-28-48-43(31-35)39-15-5-8-20-46(39)56(48)49-21-10-18-41-40-16-6-9-22-50(40)58-54(41)49/h1-32H/i1D,2D,3D,12D,13D |
| InChIKey | SFHPPVIXDOAOPO-AYAICNHJSA-N |
| XLogP | 15.01 |
| TPSA | 36.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.89 |
| LogP ≤ 5 | 15.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |