C32H22N2O4S2 — CID 168764532
[4-[5-[4-(4-methylbenzoyl)oxyphenyl]-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]phenyl] 4-methylbenzoate (PubChem CID 168764532) has the molecular formula C32H22N2O4S2 and a molecular weight of 562.67 g/mol. Its IUPAC name is [4-[5-[4-(4-methylbenzoyl)oxyphenyl]-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]phenyl] 4-methylbenzoate.
| Compound Name | [4-[5-[4-(4-methylbenzoyl)oxyphenyl]-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]phenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 168764532 |
| Molecular Formula | C32H22N2O4S2 |
| Molecular Weight | 562.67 g/mol |
| Exact Mass | 562.10 |
| IUPAC Name | [4-[5-[4-(4-methylbenzoyl)oxyphenyl]-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]phenyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2ccc(-c3nc4sc(-c5ccc(OC(=O)c6ccc(C)cc6)cc5)nc4s3)cc2)cc1 |
| InChI | InChI=1S/C32H22N2O4S2/c1-19-3-7-23(8-4-19)31(35)37-25-15-11-21(12-16-25)27-33-29-30(39-27)34-28(40-29)22-13-17-26(18-14-22)38-32(36)24-9-5-20(2)6-10-24/h3-18H,1-2H3 |
| InChIKey | UHFMKYHLTRJVOZ-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.67 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|