C25H37F2N9 — CID 168765153
2-N-[(2S)-1,1-difluoropentan-2-yl]-7-[[6-[4-[(dimethylamino)methyl]piperidin-1-yl]-5-methyl-3-pyridinyl]methyl]imidazo[2,1-f][1,2,4]triazine-2,4-diamine (PubChem CID 168765153) has the molecular formula C25H37F2N9 and a molecular weight of 501.63 g/mol. Its IUPAC name is 2-N-[(2S)-1,1-difluoropentan-2-yl]-7-[[6-[4-[(dimethylamino)methyl]piperidin-1-yl]-5-methyl-3-pyridinyl]methyl]imidazo[2,1-f][1,2,4]triazine-2,4-diamine.
| Compound Name | 2-N-[(2S)-1,1-difluoropentan-2-yl]-7-[[6-[4-[(dimethylamino)methyl]piperidin-1-yl]-5-methyl-3-pyridinyl]methyl]imidazo[2,1-f][1,2,4]triazine-2,4-diamine |
|---|---|
| PubChem CID | 168765153 |
| Molecular Formula | C25H37F2N9 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.31 |
| IUPAC Name | 2-N-[(2S)-1,1-difluoropentan-2-yl]-7-[[6-[4-[(dimethylamino)methyl]piperidin-1-yl]-5-methyl-3-pyridinyl]methyl]imidazo[2,1-f][1,2,4]triazine-2,4-diamine |
| SMILES | CCC[C@H](Nc1nc(N)c2ncc(Cc3cnc(N4CCC(CN(C)C)CC4)c(C)c3)n2n1)C(F)F |
| InChI | InChI=1S/C25H37F2N9/c1-5-6-20(21(26)27)31-25-32-22(28)24-30-14-19(36(24)33-25)12-18-11-16(2)23(29-13-18)35-9-7-17(8-10-35)15-34(3)4/h11,13-14,17,20-21H,5-10,12,15H2,1-4H3,(H3,28,31,32,33)/t20-/m0/s1 |
| InChIKey | APLJUVHSGNFVQQ-FQEVSTJZSA-N |
| XLogP | 3.62 |
| TPSA | 100.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|