C21H30N8O2 — CID 155053879
1-[4-amino-7-[(5-methyl-6-piperazin-1-yl-3-pyridinyl)methyl]imidazo[2,1-f][1,2,4]triazin-2-yl]oxypentan-2-ol (PubChem CID 155053879) has the molecular formula C21H30N8O2 and a molecular weight of 426.53 g/mol. Its IUPAC name is 1-[4-amino-7-[(5-methyl-6-piperazin-1-yl-3-pyridinyl)methyl]imidazo[2,1-f][1,2,4]triazin-2-yl]oxypentan-2-ol.
| Compound Name | 1-[4-amino-7-[(5-methyl-6-piperazin-1-yl-3-pyridinyl)methyl]imidazo[2,1-f][1,2,4]triazin-2-yl]oxypentan-2-ol |
|---|---|
| PubChem CID | 155053879 |
| Molecular Formula | C21H30N8O2 |
| Molecular Weight | 426.53 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | 1-[4-amino-7-[(5-methyl-6-piperazin-1-yl-3-pyridinyl)methyl]imidazo[2,1-f][1,2,4]triazin-2-yl]oxypentan-2-ol |
| SMILES | CCCC(O)COc1nc(N)c2ncc(Cc3cnc(N4CCNCC4)c(C)c3)n2n1 |
| InChI | InChI=1S/C21H30N8O2/c1-3-4-17(30)13-31-21-26-18(22)20-25-12-16(29(20)27-21)10-15-9-14(2)19(24-11-15)28-7-5-23-6-8-28/h9,11-12,17,23,30H,3-8,10,13H2,1-2H3,(H2,22,26,27) |
| InChIKey | KKKVNZNYNIKLSC-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 126.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.53 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|