C21H30N8O — CID 157021747
2-butoxy-7-[[6-(1,4-diazepan-1-yl)-5-methyl-3-pyridinyl]methyl]imidazo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 157021747) has the molecular formula C21H30N8O and a molecular weight of 410.53 g/mol. Its IUPAC name is 2-butoxy-7-[[6-(1,4-diazepan-1-yl)-5-methyl-3-pyridinyl]methyl]imidazo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 2-butoxy-7-[[6-(1,4-diazepan-1-yl)-5-methyl-3-pyridinyl]methyl]imidazo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 157021747 |
| Molecular Formula | C21H30N8O |
| Molecular Weight | 410.53 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | 2-butoxy-7-[[6-(1,4-diazepan-1-yl)-5-methyl-3-pyridinyl]methyl]imidazo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | CCCCOc1nc(N)c2ncc(Cc3cnc(N4CCCNCC4)c(C)c3)n2n1 |
| InChI | InChI=1S/C21H30N8O/c1-3-4-10-30-21-26-18(22)20-25-14-17(29(20)27-21)12-16-11-15(2)19(24-13-16)28-8-5-6-23-7-9-28/h11,13-14,23H,3-10,12H2,1-2H3,(H2,22,26,27) |
| InChIKey | GWUYFFNELJQCGH-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.53 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|