C20H26N8O — CID 155053769
2-but-3-enoxy-7-[(5-methyl-6-piperazin-1-yl-3-pyridinyl)methyl]imidazo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 155053769) has the molecular formula C20H26N8O and a molecular weight of 394.48 g/mol. Its IUPAC name is 2-but-3-enoxy-7-[(5-methyl-6-piperazin-1-yl-3-pyridinyl)methyl]imidazo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 2-but-3-enoxy-7-[(5-methyl-6-piperazin-1-yl-3-pyridinyl)methyl]imidazo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 155053769 |
| Molecular Formula | C20H26N8O |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | 2-but-3-enoxy-7-[(5-methyl-6-piperazin-1-yl-3-pyridinyl)methyl]imidazo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | C=CCCOc1nc(N)c2ncc(Cc3cnc(N4CCNCC4)c(C)c3)n2n1 |
| InChI | InChI=1S/C20H26N8O/c1-3-4-9-29-20-25-17(21)19-24-13-16(28(19)26-20)11-15-10-14(2)18(23-12-15)27-7-5-22-6-8-27/h3,10,12-13,22H,1,4-9,11H2,2H3,(H2,21,25,26) |
| InChIKey | CIFQDPWQQWJNRX-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|