C23H32N8O — CID 157021599
2-butoxy-7-[[6-(2,7-diazaspiro[3.5]nonan-7-yl)-5-methyl-3-pyridinyl]methyl]imidazo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 157021599) has the molecular formula C23H32N8O and a molecular weight of 436.56 g/mol. Its IUPAC name is 2-butoxy-7-[[6-(2,7-diazaspiro[3.5]nonan-7-yl)-5-methyl-3-pyridinyl]methyl]imidazo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 2-butoxy-7-[[6-(2,7-diazaspiro[3.5]nonan-7-yl)-5-methyl-3-pyridinyl]methyl]imidazo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 157021599 |
| Molecular Formula | C23H32N8O |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.27 |
| IUPAC Name | 2-butoxy-7-[[6-(2,7-diazaspiro[3.5]nonan-7-yl)-5-methyl-3-pyridinyl]methyl]imidazo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | CCCCOc1nc(N)c2ncc(Cc3cnc(N4CCC5(CC4)CNC5)c(C)c3)n2n1 |
| InChI | InChI=1S/C23H32N8O/c1-3-4-9-32-22-28-19(24)21-27-13-18(31(21)29-22)11-17-10-16(2)20(26-12-17)30-7-5-23(6-8-30)14-25-15-23/h10,12-13,25H,3-9,11,14-15H2,1-2H3,(H2,24,28,29) |
| InChIKey | ZCKLEFDEGLEKKY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|