C20H28N8O — CID 155046429
2-butoxy-7-[(2-methyl-6-piperazin-1-yl-3-pyridinyl)methyl]imidazo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 155046429) has the molecular formula C20H28N8O and a molecular weight of 396.50 g/mol. Its IUPAC name is 2-butoxy-7-[(2-methyl-6-piperazin-1-yl-3-pyridinyl)methyl]imidazo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 2-butoxy-7-[(2-methyl-6-piperazin-1-yl-3-pyridinyl)methyl]imidazo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 155046429 |
| Molecular Formula | C20H28N8O |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | 2-butoxy-7-[(2-methyl-6-piperazin-1-yl-3-pyridinyl)methyl]imidazo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | CCCCOc1nc(N)c2ncc(Cc3ccc(N4CCNCC4)nc3C)n2n1 |
| InChI | InChI=1S/C20H28N8O/c1-3-4-11-29-20-25-18(21)19-23-13-16(28(19)26-20)12-15-5-6-17(24-14(15)2)27-9-7-22-8-10-27/h5-6,13,22H,3-4,7-12H2,1-2H3,(H2,21,25,26) |
| InChIKey | RDIRRIARVMVCBC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|