C21H29N7O — CID 155046314
2-butoxy-7-[[4-(piperazin-1-ylmethyl)phenyl]methyl]imidazo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 155046314) has the molecular formula C21H29N7O and a molecular weight of 395.51 g/mol. Its IUPAC name is 2-butoxy-7-[[4-(piperazin-1-ylmethyl)phenyl]methyl]imidazo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 2-butoxy-7-[[4-(piperazin-1-ylmethyl)phenyl]methyl]imidazo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 155046314 |
| Molecular Formula | C21H29N7O |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | 2-butoxy-7-[[4-(piperazin-1-ylmethyl)phenyl]methyl]imidazo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | CCCCOc1nc(N)c2ncc(Cc3ccc(CN4CCNCC4)cc3)n2n1 |
| InChI | InChI=1S/C21H29N7O/c1-2-3-12-29-21-25-19(22)20-24-14-18(28(20)26-21)13-16-4-6-17(7-5-16)15-27-10-8-23-9-11-27/h4-7,14,23H,2-3,8-13,15H2,1H3,(H2,22,25,26) |
| InChIKey | ATIFUIQXKCLVSK-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 93.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|