C22H30N6O — CID 164738989
2-butoxy-7-[[6-(dimethylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]methyl]imidazo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 164738989) has the molecular formula C22H30N6O and a molecular weight of 394.52 g/mol. Its IUPAC name is 2-butoxy-7-[[6-(dimethylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]methyl]imidazo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 2-butoxy-7-[[6-(dimethylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]methyl]imidazo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 164738989 |
| Molecular Formula | C22H30N6O |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | 2-butoxy-7-[[6-(dimethylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]methyl]imidazo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | CCCCOc1nc(N)c2ncc(Cc3ccc4c(c3)CCC(N(C)C)C4)n2n1 |
| InChI | InChI=1S/C22H30N6O/c1-4-5-10-29-22-25-20(23)21-24-14-19(28(21)26-22)12-15-6-7-17-13-18(27(2)3)9-8-16(17)11-15/h6-7,11,14,18H,4-5,8-10,12-13H2,1-3H3,(H2,23,25,26) |
| InChIKey | PTWZBNGLSMPPFP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|