C23H29FN6O2 — CID 157021975
7-[[4-[[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-2-fluorophenyl]methyl]-2-butoxyimidazo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 157021975) has the molecular formula C23H29FN6O2 and a molecular weight of 440.52 g/mol. Its IUPAC name is 7-[[4-[[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-2-fluorophenyl]methyl]-2-butoxyimidazo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 7-[[4-[[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-2-fluorophenyl]methyl]-2-butoxyimidazo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 157021975 |
| Molecular Formula | C23H29FN6O2 |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | 7-[[4-[[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-2-fluorophenyl]methyl]-2-butoxyimidazo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | CCCCOc1nc(N)c2ncc(Cc3ccc(OC4C[C@H]5CC[C@@H](C4)N5)cc3F)n2n1 |
| InChI | InChI=1S/C23H29FN6O2/c1-2-3-8-31-23-28-21(25)22-26-13-17(30(22)29-23)9-14-4-7-18(12-20(14)24)32-19-10-15-5-6-16(11-19)27-15/h4,7,12-13,15-16,19,27H,2-3,5-6,8-11H2,1H3,(H2,25,28,29)/t15-,16+,19? |
| InChIKey | ZABCICKFRVCMJF-MCPYQZEQSA-N |
| XLogP | 3.28 |
| TPSA | 99.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|