C21H29FN6O3 — CID 175730856
(3R)-3-[4-amino-7-[[3-fluoro-4-[2-(methylamino)ethoxy]phenyl]methyl]imidazo[2,1-f][1,2,4]triazin-2-yl]oxyhexan-1-ol (PubChem CID 175730856) has the molecular formula C21H29FN6O3 and a molecular weight of 432.50 g/mol. Its IUPAC name is (3R)-3-[4-amino-7-[[3-fluoro-4-[2-(methylamino)ethoxy]phenyl]methyl]imidazo[2,1-f][1,2,4]triazin-2-yl]oxyhexan-1-ol.
| Compound Name | (3R)-3-[4-amino-7-[[3-fluoro-4-[2-(methylamino)ethoxy]phenyl]methyl]imidazo[2,1-f][1,2,4]triazin-2-yl]oxyhexan-1-ol |
|---|---|
| PubChem CID | 175730856 |
| Molecular Formula | C21H29FN6O3 |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | (3R)-3-[4-amino-7-[[3-fluoro-4-[2-(methylamino)ethoxy]phenyl]methyl]imidazo[2,1-f][1,2,4]triazin-2-yl]oxyhexan-1-ol |
| SMILES | CCC[C@H](CCO)Oc1nc(N)c2ncc(Cc3ccc(OCCNC)c(F)c3)n2n1 |
| InChI | InChI=1S/C21H29FN6O3/c1-3-4-16(7-9-29)31-21-26-19(23)20-25-13-15(28(20)27-21)11-14-5-6-18(17(22)12-14)30-10-8-24-2/h5-6,12-13,16,24,29H,3-4,7-11H2,1-2H3,(H2,23,26,27)/t16-/m1/s1 |
| InChIKey | DCSRCDFHJLKXLH-MRXNPFEDSA-N |
| XLogP | 1.96 |
| TPSA | 119.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|