C21H30N6O3 — CID 157021944
3-[4-amino-7-[[3-[2-(methylamino)ethoxy]phenyl]methyl]imidazo[2,1-f][1,2,4]triazin-2-yl]oxyhexan-1-ol (PubChem CID 157021944) has the molecular formula C21H30N6O3 and a molecular weight of 414.51 g/mol. Its IUPAC name is 3-[4-amino-7-[[3-[2-(methylamino)ethoxy]phenyl]methyl]imidazo[2,1-f][1,2,4]triazin-2-yl]oxyhexan-1-ol.
| Compound Name | 3-[4-amino-7-[[3-[2-(methylamino)ethoxy]phenyl]methyl]imidazo[2,1-f][1,2,4]triazin-2-yl]oxyhexan-1-ol |
|---|---|
| PubChem CID | 157021944 |
| Molecular Formula | C21H30N6O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | 3-[4-amino-7-[[3-[2-(methylamino)ethoxy]phenyl]methyl]imidazo[2,1-f][1,2,4]triazin-2-yl]oxyhexan-1-ol |
| SMILES | CCCC(CCO)Oc1nc(N)c2ncc(Cc3cccc(OCCNC)c3)n2n1 |
| InChI | InChI=1S/C21H30N6O3/c1-3-5-17(8-10-28)30-21-25-19(22)20-24-14-16(27(20)26-21)12-15-6-4-7-18(13-15)29-11-9-23-2/h4,6-7,13-14,17,23,28H,3,5,8-12H2,1-2H3,(H2,22,25,26) |
| InChIKey | AKBSXNPOYHQGSN-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 119.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|