C22H32N6O4 — CID 165087918
3-[4-amino-7-[(6-butoxy-2-methoxy-3-pyridinyl)methyl]imidazo[2,1-f][1,2,4]triazin-2-yl]oxyhexan-1-ol (PubChem CID 165087918) has the molecular formula C22H32N6O4 and a molecular weight of 444.54 g/mol. Its IUPAC name is 3-[4-amino-7-[(6-butoxy-2-methoxy-3-pyridinyl)methyl]imidazo[2,1-f][1,2,4]triazin-2-yl]oxyhexan-1-ol.
| Compound Name | 3-[4-amino-7-[(6-butoxy-2-methoxy-3-pyridinyl)methyl]imidazo[2,1-f][1,2,4]triazin-2-yl]oxyhexan-1-ol |
|---|---|
| PubChem CID | 165087918 |
| Molecular Formula | C22H32N6O4 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | 3-[4-amino-7-[(6-butoxy-2-methoxy-3-pyridinyl)methyl]imidazo[2,1-f][1,2,4]triazin-2-yl]oxyhexan-1-ol |
| SMILES | CCCCOc1ccc(Cc2cnc3c(N)nc(OC(CCC)CCO)nn23)c(OC)n1 |
| InChI | InChI=1S/C22H32N6O4/c1-4-6-12-31-18-9-8-15(21(25-18)30-3)13-16-14-24-20-19(23)26-22(27-28(16)20)32-17(7-5-2)10-11-29/h8-9,14,17,29H,4-7,10-13H2,1-3H3,(H2,23,26,27) |
| InChIKey | WGPAYKCAMDHNKX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 129.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|