C23H32N6O4 — CID 155046332
methyl 5-[(4-amino-2-butoxyimidazo[2,1-f][1,2,4]triazin-7-yl)methyl]-2-[3-(dimethylamino)propoxy]benzoate (PubChem CID 155046332) has the molecular formula C23H32N6O4 and a molecular weight of 456.55 g/mol. Its IUPAC name is methyl 5-[(4-amino-2-butoxyimidazo[2,1-f][1,2,4]triazin-7-yl)methyl]-2-[3-(dimethylamino)propoxy]benzoate.
| Compound Name | methyl 5-[(4-amino-2-butoxyimidazo[2,1-f][1,2,4]triazin-7-yl)methyl]-2-[3-(dimethylamino)propoxy]benzoate |
|---|---|
| PubChem CID | 155046332 |
| Molecular Formula | C23H32N6O4 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | methyl 5-[(4-amino-2-butoxyimidazo[2,1-f][1,2,4]triazin-7-yl)methyl]-2-[3-(dimethylamino)propoxy]benzoate |
| SMILES | CCCCOc1nc(N)c2ncc(Cc3ccc(OCCCN(C)C)c(C(=O)OC)c3)n2n1 |
| InChI | InChI=1S/C23H32N6O4/c1-5-6-11-33-23-26-20(24)21-25-15-17(29(21)27-23)13-16-8-9-19(18(14-16)22(30)31-4)32-12-7-10-28(2)3/h8-9,14-15H,5-7,10-13H2,1-4H3,(H2,24,26,27) |
| InChIKey | BJTWHFUPECHCOX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 117.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|