C26H39N9O2 — CID 155053763
(2S,3S)-2-amino-1-[4-[5-[(4-amino-2-butoxyimidazo[2,1-f][1,2,4]triazin-7-yl)methyl]-3-methyl-2-pyridinyl]piperazin-1-yl]-3-methylpentan-1-one (PubChem CID 155053763) has the molecular formula C26H39N9O2 and a molecular weight of 509.66 g/mol. Its IUPAC name is (2S,3S)-2-amino-1-[4-[5-[(4-amino-2-butoxyimidazo[2,1-f][1,2,4]triazin-7-yl)methyl]-3-methyl-2-pyridinyl]piperazin-1-yl]-3-methylpentan-1-one.
| Compound Name | (2S,3S)-2-amino-1-[4-[5-[(4-amino-2-butoxyimidazo[2,1-f][1,2,4]triazin-7-yl)methyl]-3-methyl-2-pyridinyl]piperazin-1-yl]-3-methylpentan-1-one |
|---|---|
| PubChem CID | 155053763 |
| Molecular Formula | C26H39N9O2 |
| Molecular Weight | 509.66 g/mol |
| Exact Mass | 509.32 |
| IUPAC Name | (2S,3S)-2-amino-1-[4-[5-[(4-amino-2-butoxyimidazo[2,1-f][1,2,4]triazin-7-yl)methyl]-3-methyl-2-pyridinyl]piperazin-1-yl]-3-methylpentan-1-one |
| SMILES | CCCCOc1nc(N)c2ncc(Cc3cnc(N4CCN(C(=O)[C@@H](N)[C@@H](C)CC)CC4)c(C)c3)n2n1 |
| InChI | InChI=1S/C26H39N9O2/c1-5-7-12-37-26-31-22(28)24-30-16-20(35(24)32-26)14-19-13-18(4)23(29-15-19)33-8-10-34(11-9-33)25(36)21(27)17(3)6-2/h13,15-17,21H,5-12,14,27H2,1-4H3,(H2,28,31,32)/t17-,21-/m0/s1 |
| InChIKey | SSWVWNDZTMAGCD-UWJYYQICSA-N |
| XLogP | 2.20 |
| TPSA | 140.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.66 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|