C22H29N7O3 — CID 175594964
[7-amino-5-butoxy-3-[[4-(piperazin-1-ylmethyl)phenyl]methyl]pyrazolo[4,5-d]pyrimidin-1-yl] formate (PubChem CID 175594964) has the molecular formula C22H29N7O3 and a molecular weight of 439.52 g/mol. Its IUPAC name is [7-amino-5-butoxy-3-[[4-(piperazin-1-ylmethyl)phenyl]methyl]pyrazolo[4,5-d]pyrimidin-1-yl] formate.
| Compound Name | [7-amino-5-butoxy-3-[[4-(piperazin-1-ylmethyl)phenyl]methyl]pyrazolo[4,5-d]pyrimidin-1-yl] formate |
|---|---|
| PubChem CID | 175594964 |
| Molecular Formula | C22H29N7O3 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | [7-amino-5-butoxy-3-[[4-(piperazin-1-ylmethyl)phenyl]methyl]pyrazolo[4,5-d]pyrimidin-1-yl] formate |
| SMILES | CCCCOc1nc(N)c2c(n1)c(Cc1ccc(CN3CCNCC3)cc1)nn2OC=O |
| InChI | InChI=1S/C22H29N7O3/c1-2-3-12-31-22-25-19-18(27-29(32-15-30)20(19)21(23)26-22)13-16-4-6-17(7-5-16)14-28-10-8-24-9-11-28/h4-7,15,24H,2-3,8-14H2,1H3,(H2,23,25,26) |
| InChIKey | FNDHRNLYLSZIHV-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|