C27H34N8O3 — CID 162353730
1-[2-[4-[[4-[(7-amino-5-butoxy-2H-pyrazolo[4,3-d]pyrimidin-3-yl)methyl]phenyl]methyl]piperazin-1-yl]ethyl]pyrrole-2,5-dione (PubChem CID 162353730) has the molecular formula C27H34N8O3 and a molecular weight of 518.62 g/mol. Its IUPAC name is 1-[2-[4-[[4-[(7-amino-5-butoxy-2H-pyrazolo[4,3-d]pyrimidin-3-yl)methyl]phenyl]methyl]piperazin-1-yl]ethyl]pyrrole-2,5-dione.
| Compound Name | 1-[2-[4-[[4-[(7-amino-5-butoxy-2H-pyrazolo[4,3-d]pyrimidin-3-yl)methyl]phenyl]methyl]piperazin-1-yl]ethyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 162353730 |
| Molecular Formula | C27H34N8O3 |
| Molecular Weight | 518.62 g/mol |
| Exact Mass | 518.28 |
| IUPAC Name | 1-[2-[4-[[4-[(7-amino-5-butoxy-2H-pyrazolo[4,3-d]pyrimidin-3-yl)methyl]phenyl]methyl]piperazin-1-yl]ethyl]pyrrole-2,5-dione |
| SMILES | CCCCOc1nc(N)c2n[nH]c(Cc3ccc(CN4CCN(CCN5C(=O)C=CC5=O)CC4)cc3)c2n1 |
| InChI | InChI=1S/C27H34N8O3/c1-2-3-16-38-27-29-24-21(31-32-25(24)26(28)30-27)17-19-4-6-20(7-5-19)18-34-12-10-33(11-13-34)14-15-35-22(36)8-9-23(35)37/h4-9H,2-3,10-18H2,1H3,(H,31,32)(H2,28,29,30) |
| InChIKey | HKCKYVCZAJAIIV-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 133.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.62 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|