C20H26N6O — CID 162353695
5-butoxy-3-[[4-[(cyclopropylamino)methyl]phenyl]methyl]-2H-pyrazolo[4,3-d]pyrimidin-7-amine (PubChem CID 162353695) has the molecular formula C20H26N6O and a molecular weight of 366.47 g/mol. Its IUPAC name is 5-butoxy-3-[[4-[(cyclopropylamino)methyl]phenyl]methyl]-2H-pyrazolo[4,3-d]pyrimidin-7-amine.
| Compound Name | 5-butoxy-3-[[4-[(cyclopropylamino)methyl]phenyl]methyl]-2H-pyrazolo[4,3-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 162353695 |
| Molecular Formula | C20H26N6O |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 5-butoxy-3-[[4-[(cyclopropylamino)methyl]phenyl]methyl]-2H-pyrazolo[4,3-d]pyrimidin-7-amine |
| SMILES | CCCCOc1nc(N)c2n[nH]c(Cc3ccc(CNC4CC4)cc3)c2n1 |
| InChI | InChI=1S/C20H26N6O/c1-2-3-10-27-20-23-17-16(25-26-18(17)19(21)24-20)11-13-4-6-14(7-5-13)12-22-15-8-9-15/h4-7,15,22H,2-3,8-12H2,1H3,(H,25,26)(H2,21,23,24) |
| InChIKey | BMNVBNAUHKPEST-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|