C23H33N7O2 — CID 162353727
5-butoxy-3-[[2-methoxy-4-[[(3S)-3-methylpiperazin-1-yl]methyl]phenyl]methyl]-2H-pyrazolo[4,3-d]pyrimidin-7-amine (PubChem CID 162353727) has the molecular formula C23H33N7O2 and a molecular weight of 439.56 g/mol. Its IUPAC name is 5-butoxy-3-[[2-methoxy-4-[[(3S)-3-methylpiperazin-1-yl]methyl]phenyl]methyl]-2H-pyrazolo[4,3-d]pyrimidin-7-amine.
| Compound Name | 5-butoxy-3-[[2-methoxy-4-[[(3S)-3-methylpiperazin-1-yl]methyl]phenyl]methyl]-2H-pyrazolo[4,3-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 162353727 |
| Molecular Formula | C23H33N7O2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | 5-butoxy-3-[[2-methoxy-4-[[(3S)-3-methylpiperazin-1-yl]methyl]phenyl]methyl]-2H-pyrazolo[4,3-d]pyrimidin-7-amine |
| SMILES | CCCCOc1nc(N)c2n[nH]c(Cc3ccc(CN4CCN[C@@H](C)C4)cc3OC)c2n1 |
| InChI | InChI=1S/C23H33N7O2/c1-4-5-10-32-23-26-20-18(28-29-21(20)22(24)27-23)12-17-7-6-16(11-19(17)31-3)14-30-9-8-25-15(2)13-30/h6-7,11,15,25H,4-5,8-10,12-14H2,1-3H3,(H,28,29)(H2,24,26,27)/t15-/m0/s1 |
| InChIKey | DPNRJAUPTTUZJH-HNNXBMFYSA-N |
| XLogP | 2.51 |
| TPSA | 114.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|