C24H33N7O4 — CID 175174815
[7-amino-3-[[4-[(4-aminopiperidin-1-yl)methyl]-2-methoxyphenyl]methyl]-5-butoxypyrazolo[4,5-d]pyrimidin-1-yl] formate (PubChem CID 175174815) has the molecular formula C24H33N7O4 and a molecular weight of 483.57 g/mol. Its IUPAC name is [7-amino-3-[[4-[(4-aminopiperidin-1-yl)methyl]-2-methoxyphenyl]methyl]-5-butoxypyrazolo[4,5-d]pyrimidin-1-yl] formate.
| Compound Name | [7-amino-3-[[4-[(4-aminopiperidin-1-yl)methyl]-2-methoxyphenyl]methyl]-5-butoxypyrazolo[4,5-d]pyrimidin-1-yl] formate |
|---|---|
| PubChem CID | 175174815 |
| Molecular Formula | C24H33N7O4 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.26 |
| IUPAC Name | [7-amino-3-[[4-[(4-aminopiperidin-1-yl)methyl]-2-methoxyphenyl]methyl]-5-butoxypyrazolo[4,5-d]pyrimidin-1-yl] formate |
| SMILES | CCCCOc1nc(N)c2c(n1)c(Cc1ccc(CN3CCC(N)CC3)cc1OC)nn2OC=O |
| InChI | InChI=1S/C24H33N7O4/c1-3-4-11-34-24-27-21-19(29-31(35-15-32)22(21)23(26)28-24)13-17-6-5-16(12-20(17)33-2)14-30-9-7-18(25)8-10-30/h5-6,12,15,18H,3-4,7-11,13-14,25H2,1-2H3,(H2,26,27,28) |
| InChIKey | BMCKZAVKFHRTGJ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 143.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|